C17H23NO — CID 114619851
5-cyclohex-2-en-1-yloxy-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 114619851) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is 5-cyclohex-2-en-1-yloxy-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | 5-cyclohex-2-en-1-yloxy-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 114619851 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | 5-cyclohex-2-en-1-yloxy-N-methyl-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | CNC1CCCc2c(OC3C=CCCC3)cccc21 |
| InChI | InChI=1S/C17H23NO/c1-18-16-11-5-10-15-14(16)9-6-12-17(15)19-13-7-3-2-4-8-13/h3,6-7,9,12-13,16,18H,2,4-5,8,10-11H2,1H3 |
| InChIKey | FOVDIRUIYMVSHO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|