About 3-[3-[3-(3-hydroxy-2,2-dimethylpropyl)phenoxy]phenyl]-2,2-dimethylpropan-1-ol
3-[3-[3-(3-hydroxy-2,2-dimethylpropyl)phenoxy]phenyl]-2,2-dimethylpropan-1-ol (PubChem CID 11462008) has the molecular formula C22H30O3
and a molecular weight of 342.48 g/mol. Its IUPAC name is 3-[3-[3-(3-hydroxy-2,2-dimethylpropyl)phenoxy]phenyl]-2,2-dimethylpropan-1-ol.
Molecular Properties
| Compound Name | 3-[3-[3-(3-hydroxy-2,2-dimethylpropyl)phenoxy]phenyl]-2,2-dimethylpropan-1-ol |
| PubChem CID | 11462008 |
| Molecular Formula | C22H30O3 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | 3-[3-[3-(3-hydroxy-2,2-dimethylpropyl)phenoxy]phenyl]-2,2-dimethylpropan-1-ol |
| SMILES | CC(C)(CO)Cc1cccc(Oc2cccc(CC(C)(C)CO)c2)c1 |
| InChI | InChI=1S/C22H30O3/c1-21(2,15-23)13-17-7-5-9-19(11-17)25-20-10-6-8-18(12-20)14-22(3,4)16-24/h5-12,23-24H,13-16H2,1-4H3 |
| InChIKey | GYUZZNNWIOGAQI-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[3-[3-(3-hydroxy-2,2-dimethylpropyl)phenoxy]phenyl]-2,2-dimethylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-[3-(3-hydroxy-2,2-dimethylpropyl)phenoxy]phenyl]-2,2-dimethylpropan-1-ol?
The IUPAC name of 3-[3-[3-(3-hydroxy-2,2-dimethylpropyl)phenoxy]phenyl]-2,2-dimethylpropan-1-ol (CID 11462008) is 3-[3-[3-(3-hydroxy-2,2-dimethylpropyl)phenoxy]phenyl]-2,2-dimethylpropan-1-ol.
What is the SMILES notation for 3-[3-[3-(3-hydroxy-2,2-dimethylpropyl)phenoxy]phenyl]-2,2-dimethylpropan-1-ol?
The canonical SMILES for 3-[3-[3-(3-hydroxy-2,2-dimethylpropyl)phenoxy]phenyl]-2,2-dimethylpropan-1-ol is CC(C)(CO)Cc1cccc(Oc2cccc(CC(C)(C)CO)c2)c1.
What is the InChIKey of 3-[3-[3-(3-hydroxy-2,2-dimethylpropyl)phenoxy]phenyl]-2,2-dimethylpropan-1-ol?
The InChIKey is GYUZZNNWIOGAQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H30O3/c1-21(2,15-23)13-17-7-5-9-19(11-17)25-20-10-6-8-18(12-20)14-22(3,4)16-24/h5-12,23-24H,13-16H2,1-4H3.
What are the key properties of 3-[3-[3-(3-hydroxy-2,2-dimethylpropyl)phenoxy]phenyl]-2,2-dimethylpropan-1-ol?
3-[3-[3-(3-hydroxy-2,2-dimethylpropyl)phenoxy]phenyl]-2,2-dimethylpropan-1-ol has a molecular weight of 342.48 g/mol, XLogP of 4.60, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-[3-(3-hydroxy-2,2-dimethylpropyl)phenoxy]phenyl]-2,2-dimethylpropan-1-ol is sourced from PubChem (CID 11462008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).