C18H36O4Si — CID 11462076
(7S,8R)-8-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-7,9-dimethyldecane-2,4-dione (PubChem CID 11462076) has the molecular formula C18H36O4Si and a molecular weight of 344.57 g/mol. Its IUPAC name is (7S,8R)-8-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-7,9-dimethyldecane-2,4-dione.
| Compound Name | (7S,8R)-8-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-7,9-dimethyldecane-2,4-dione |
|---|---|
| PubChem CID | 11462076 |
| Molecular Formula | C18H36O4Si |
| Molecular Weight | 344.57 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | (7S,8R)-8-[tert-butyl(dimethyl)silyl]oxy-6-hydroxy-7,9-dimethyldecane-2,4-dione |
| SMILES | CC(=O)CC(=O)CC(O)[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C18H36O4Si/c1-12(2)17(22-23(8,9)18(5,6)7)14(4)16(21)11-15(20)10-13(3)19/h12,14,16-17,21H,10-11H2,1-9H3/t14-,16?,17+/m0/s1 |
| InChIKey | CZOWEPHTWAZSLM-DRXWIORDSA-N |
| XLogP | 3.97 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.57 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|