C19H15N5O2 — CID 11462094
4-[8-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a]pyrazin-6-yl]-2-phenylbut-3-yn-2-ol (PubChem CID 11462094) has the molecular formula C19H15N5O2 and a molecular weight of 345.36 g/mol. Its IUPAC name is 4-[8-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a]pyrazin-6-yl]-2-phenylbut-3-yn-2-ol.
| Compound Name | 4-[8-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a]pyrazin-6-yl]-2-phenylbut-3-yn-2-ol |
|---|---|
| PubChem CID | 11462094 |
| Molecular Formula | C19H15N5O2 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 4-[8-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a]pyrazin-6-yl]-2-phenylbut-3-yn-2-ol |
| SMILES | CC(O)(C#Cc1cn2nc(-c3ccco3)nc2c(N)n1)c1ccccc1 |
| InChI | InChI=1S/C19H15N5O2/c1-19(25,13-6-3-2-4-7-13)10-9-14-12-24-18(16(20)21-14)22-17(23-24)15-8-5-11-26-15/h2-8,11-12,25H,1H3,(H2,20,21) |
| InChIKey | MUBQTNOOAXJJSD-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 102.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|