C17H27NO2 — CID 114621071
1-[2-(2,2,5,5-tetramethyloxolan-3-yl)oxyphenyl]propan-1-amine (PubChem CID 114621071) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is 1-[2-(2,2,5,5-tetramethyloxolan-3-yl)oxyphenyl]propan-1-amine.
| Compound Name | 1-[2-(2,2,5,5-tetramethyloxolan-3-yl)oxyphenyl]propan-1-amine |
|---|---|
| PubChem CID | 114621071 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | 1-[2-(2,2,5,5-tetramethyloxolan-3-yl)oxyphenyl]propan-1-amine |
| SMILES | CCC(N)c1ccccc1OC1CC(C)(C)OC1(C)C |
| InChI | InChI=1S/C17H27NO2/c1-6-13(18)12-9-7-8-10-14(12)19-15-11-16(2,3)20-17(15,4)5/h7-10,13,15H,6,11,18H2,1-5H3 |
| InChIKey | GJMIHDRHRSLFIA-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |