C10H18N4O — CID 114621254
1-(2,2,5,5-tetramethyloxolan-3-yl)-1,2,4-triazol-3-amine (PubChem CID 114621254) has the molecular formula C10H18N4O and a molecular weight of 210.28 g/mol. Its IUPAC name is 1-(2,2,5,5-tetramethyloxolan-3-yl)-1,2,4-triazol-3-amine.
| Compound Name | 1-(2,2,5,5-tetramethyloxolan-3-yl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 114621254 |
| Molecular Formula | C10H18N4O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | 1-(2,2,5,5-tetramethyloxolan-3-yl)-1,2,4-triazol-3-amine |
| SMILES | CC1(C)CC(n2cnc(N)n2)C(C)(C)O1 |
| InChI | InChI=1S/C10H18N4O/c1-9(2)5-7(10(3,4)15-9)14-6-12-8(11)13-14/h6-7H,5H2,1-4H3,(H2,11,13) |
| InChIKey | ZFFAJKTXTXVZEM-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |