C15H21NO3 — CID 114621429
6-methyl-3-(2,2,5,5-tetramethyloxolan-3-yl)oxypyridine-2-carbaldehyde (PubChem CID 114621429) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is 6-methyl-3-(2,2,5,5-tetramethyloxolan-3-yl)oxypyridine-2-carbaldehyde.
| Compound Name | 6-methyl-3-(2,2,5,5-tetramethyloxolan-3-yl)oxypyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 114621429 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 6-methyl-3-(2,2,5,5-tetramethyloxolan-3-yl)oxypyridine-2-carbaldehyde |
| SMILES | Cc1ccc(OC2CC(C)(C)OC2(C)C)c(C=O)n1 |
| InChI | InChI=1S/C15H21NO3/c1-10-6-7-12(11(9-17)16-10)18-13-8-14(2,3)19-15(13,4)5/h6-7,9,13H,8H2,1-5H3 |
| InChIKey | CKHCTNFMEYVISF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|