C14H21NOS — CID 114621520
4-(2,2,5,5-tetramethyloxolan-3-yl)sulfanylaniline (PubChem CID 114621520) has the molecular formula C14H21NOS and a molecular weight of 251.39 g/mol. Its IUPAC name is 4-(2,2,5,5-tetramethyloxolan-3-yl)sulfanylaniline.
| Compound Name | 4-(2,2,5,5-tetramethyloxolan-3-yl)sulfanylaniline |
|---|---|
| PubChem CID | 114621520 |
| Molecular Formula | C14H21NOS |
| Molecular Weight | 251.39 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 4-(2,2,5,5-tetramethyloxolan-3-yl)sulfanylaniline |
| SMILES | CC1(C)CC(Sc2ccc(N)cc2)C(C)(C)O1 |
| InChI | InChI=1S/C14H21NOS/c1-13(2)9-12(14(3,4)16-13)17-11-7-5-10(15)6-8-11/h5-8,12H,9,15H2,1-4H3 |
| InChIKey | DZMZKRJDLFIUNV-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|