C16H25NO2S — CID 114621555
4-ethoxy-2-(2,2,5,5-tetramethyloxolan-3-yl)sulfanylaniline (PubChem CID 114621555) has the molecular formula C16H25NO2S and a molecular weight of 295.45 g/mol. Its IUPAC name is 4-ethoxy-2-(2,2,5,5-tetramethyloxolan-3-yl)sulfanylaniline.
| Compound Name | 4-ethoxy-2-(2,2,5,5-tetramethyloxolan-3-yl)sulfanylaniline |
|---|---|
| PubChem CID | 114621555 |
| Molecular Formula | C16H25NO2S |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 4-ethoxy-2-(2,2,5,5-tetramethyloxolan-3-yl)sulfanylaniline |
| SMILES | CCOc1ccc(N)c(SC2CC(C)(C)OC2(C)C)c1 |
| InChI | InChI=1S/C16H25NO2S/c1-6-18-11-7-8-12(17)13(9-11)20-14-10-15(2,3)19-16(14,4)5/h7-9,14H,6,10,17H2,1-5H3 |
| InChIKey | YEYZYTMVVMBGKX-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|