About 2,6,8-triphenyl-7H-purine
2,6,8-triphenyl-7H-purine (PubChem CID 11462181) has the molecular formula C23H16N4
and a molecular weight of 348.41 g/mol. Its IUPAC name is 2,6,8-triphenyl-7H-purine.
Molecular Properties
| Compound Name | 2,6,8-triphenyl-7H-purine |
| PubChem CID | 11462181 |
| Molecular Formula | C23H16N4 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 2,6,8-triphenyl-7H-purine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)c3[nH]c(-c4ccccc4)nc3n2)cc1 |
| InChI | InChI=1S/C23H16N4/c1-4-10-16(11-5-1)19-20-23(26-21(24-19)17-12-6-2-7-13-17)27-22(25-20)18-14-8-3-9-15-18/h1-15H,(H,24,25,26,27) |
| InChIKey | UHWGSYGCZUMSMO-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,6,8-triphenyl-7H-purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6,8-triphenyl-7H-purine?
The IUPAC name of 2,6,8-triphenyl-7H-purine (CID 11462181) is 2,6,8-triphenyl-7H-purine.
What is the SMILES notation for 2,6,8-triphenyl-7H-purine?
The canonical SMILES for 2,6,8-triphenyl-7H-purine is c1ccc(-c2nc(-c3ccccc3)c3[nH]c(-c4ccccc4)nc3n2)cc1.
What is the InChIKey of 2,6,8-triphenyl-7H-purine?
The InChIKey is UHWGSYGCZUMSMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H16N4/c1-4-10-16(11-5-1)19-20-23(26-21(24-19)17-12-6-2-7-13-17)27-22(25-20)18-14-8-3-9-15-18/h1-15H,(H,24,25,26,27).
What are the key properties of 2,6,8-triphenyl-7H-purine?
2,6,8-triphenyl-7H-purine has a molecular weight of 348.41 g/mol, XLogP of 5.35, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6,8-triphenyl-7H-purine is sourced from PubChem (CID 11462181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).