C19H28O2 — CID 114621902
5-(2,2,5,5-tetramethyloxolan-3-yl)-6,7,8,9-tetrahydrobenzo[7]annulen-5-ol (PubChem CID 114621902) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is 5-(2,2,5,5-tetramethyloxolan-3-yl)-6,7,8,9-tetrahydrobenzo[7]annulen-5-ol.
| Compound Name | 5-(2,2,5,5-tetramethyloxolan-3-yl)-6,7,8,9-tetrahydrobenzo[7]annulen-5-ol |
|---|---|
| PubChem CID | 114621902 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | 5-(2,2,5,5-tetramethyloxolan-3-yl)-6,7,8,9-tetrahydrobenzo[7]annulen-5-ol |
| SMILES | CC1(C)CC(C2(O)CCCCc3ccccc32)C(C)(C)O1 |
| InChI | InChI=1S/C19H28O2/c1-17(2)13-16(18(3,4)21-17)19(20)12-8-7-10-14-9-5-6-11-15(14)19/h5-6,9,11,16,20H,7-8,10,12-13H2,1-4H3 |
| InChIKey | FLMMYQKVAZONOT-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |