C16H32O6Si — CID 11462195
(2S,3S,5R,6R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxane-2-carbaldehyde (PubChem CID 11462195) has the molecular formula C16H32O6Si and a molecular weight of 348.51 g/mol. Its IUPAC name is (2S,3S,5R,6R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxane-2-carbaldehyde.
| Compound Name | (2S,3S,5R,6R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxane-2-carbaldehyde |
|---|---|
| PubChem CID | 11462195 |
| Molecular Formula | C16H32O6Si |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | (2S,3S,5R,6R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxane-2-carbaldehyde |
| SMILES | CO[C@]1(C)O[C@@H](CO[Si](C)(C)C(C)(C)C)[C@@H](C=O)O[C@@]1(C)OC |
| InChI | InChI=1S/C16H32O6Si/c1-14(2,3)23(8,9)20-11-13-12(10-17)21-15(4,18-6)16(5,19-7)22-13/h10,12-13H,11H2,1-9H3/t12-,13+,15-,16-/m1/s1 |
| InChIKey | RUKMUEXKWHXCQB-OCVGTWLNSA-N |
| XLogP | 2.72 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|