C22H36O3 — CID 11462198
1,13-dihydroxy-2,2,12-trimethyl-12-phenyltridecan-7-one (PubChem CID 11462198) has the molecular formula C22H36O3 and a molecular weight of 348.53 g/mol. Its IUPAC name is 1,13-dihydroxy-2,2,12-trimethyl-12-phenyltridecan-7-one.
| Compound Name | 1,13-dihydroxy-2,2,12-trimethyl-12-phenyltridecan-7-one |
|---|---|
| PubChem CID | 11462198 |
| Molecular Formula | C22H36O3 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.27 |
| IUPAC Name | 1,13-dihydroxy-2,2,12-trimethyl-12-phenyltridecan-7-one |
| SMILES | CC(C)(CO)CCCCC(=O)CCCCC(C)(CO)c1ccccc1 |
| InChI | InChI=1S/C22H36O3/c1-21(2,17-23)15-9-7-13-20(25)14-8-10-16-22(3,18-24)19-11-5-4-6-12-19/h4-6,11-12,23-24H,7-10,13-18H2,1-3H3 |
| InChIKey | SLICVXSQFVFRGW-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|