C13H26O4 — CID 114622105
1,1-dimethoxy-2-(2,2,5,5-tetramethyloxolan-3-yl)propan-2-ol (PubChem CID 114622105) has the molecular formula C13H26O4 and a molecular weight of 246.35 g/mol. Its IUPAC name is 1,1-dimethoxy-2-(2,2,5,5-tetramethyloxolan-3-yl)propan-2-ol.
| Compound Name | 1,1-dimethoxy-2-(2,2,5,5-tetramethyloxolan-3-yl)propan-2-ol |
|---|---|
| PubChem CID | 114622105 |
| Molecular Formula | C13H26O4 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | 1,1-dimethoxy-2-(2,2,5,5-tetramethyloxolan-3-yl)propan-2-ol |
| SMILES | COC(OC)C(C)(O)C1CC(C)(C)OC1(C)C |
| InChI | InChI=1S/C13H26O4/c1-11(2)8-9(12(3,4)17-11)13(5,14)10(15-6)16-7/h9-10,14H,8H2,1-7H3 |
| InChIKey | SAJONJYQEAEDMN-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|