C14H26O2S — CID 114622120
2-methyl-3-(2,2,5,5-tetramethyloxolan-3-yl)thian-3-ol (PubChem CID 114622120) has the molecular formula C14H26O2S and a molecular weight of 258.43 g/mol. Its IUPAC name is 2-methyl-3-(2,2,5,5-tetramethyloxolan-3-yl)thian-3-ol.
| Compound Name | 2-methyl-3-(2,2,5,5-tetramethyloxolan-3-yl)thian-3-ol |
|---|---|
| PubChem CID | 114622120 |
| Molecular Formula | C14H26O2S |
| Molecular Weight | 258.43 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 2-methyl-3-(2,2,5,5-tetramethyloxolan-3-yl)thian-3-ol |
| SMILES | CC1SCCCC1(O)C1CC(C)(C)OC1(C)C |
| InChI | InChI=1S/C14H26O2S/c1-10-14(15,7-6-8-17-10)11-9-12(2,3)16-13(11,4)5/h10-11,15H,6-9H2,1-5H3 |
| InChIKey | AEYOLQSYOGNFQT-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.43 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |