C18H34O2 — CID 114622197
3,3,5,5-tetramethyl-1-(2,2,5,5-tetramethyloxolan-3-yl)cyclohexan-1-ol (PubChem CID 114622197) has the molecular formula C18H34O2 and a molecular weight of 282.47 g/mol. Its IUPAC name is 3,3,5,5-tetramethyl-1-(2,2,5,5-tetramethyloxolan-3-yl)cyclohexan-1-ol.
| Compound Name | 3,3,5,5-tetramethyl-1-(2,2,5,5-tetramethyloxolan-3-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 114622197 |
| Molecular Formula | C18H34O2 |
| Molecular Weight | 282.47 g/mol |
| Exact Mass | 282.26 |
| IUPAC Name | 3,3,5,5-tetramethyl-1-(2,2,5,5-tetramethyloxolan-3-yl)cyclohexan-1-ol |
| SMILES | CC1(C)CC(C)(C)CC(O)(C2CC(C)(C)OC2(C)C)C1 |
| InChI | InChI=1S/C18H34O2/c1-14(2)10-15(3,4)12-18(19,11-14)13-9-16(5,6)20-17(13,7)8/h13,19H,9-12H2,1-8H3 |
| InChIKey | VQODUNMWWVJSRK-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.47 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |