C19H29NO — CID 114623179
1,2,3,4-tetrahydronaphthalen-2-yl-(2,2,5,5-tetramethyloxolan-3-yl)methanamine (PubChem CID 114623179) has the molecular formula C19H29NO and a molecular weight of 287.45 g/mol. Its IUPAC name is 1,2,3,4-tetrahydronaphthalen-2-yl-(2,2,5,5-tetramethyloxolan-3-yl)methanamine.
| Compound Name | 1,2,3,4-tetrahydronaphthalen-2-yl-(2,2,5,5-tetramethyloxolan-3-yl)methanamine |
|---|---|
| PubChem CID | 114623179 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | 1,2,3,4-tetrahydronaphthalen-2-yl-(2,2,5,5-tetramethyloxolan-3-yl)methanamine |
| SMILES | CC1(C)CC(C(N)C2CCc3ccccc3C2)C(C)(C)O1 |
| InChI | InChI=1S/C19H29NO/c1-18(2)12-16(19(3,4)21-18)17(20)15-10-9-13-7-5-6-8-14(13)11-15/h5-8,15-17H,9-12,20H2,1-4H3 |
| InChIKey | XSCHPSALQOTVAP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |