C16H34N2O — CID 114623234
1-N,2-N,2-N,2-tetramethyl-1-(2,2,5,5-tetramethyloxolan-3-yl)butane-1,2-diamine (PubChem CID 114623234) has the molecular formula C16H34N2O and a molecular weight of 270.46 g/mol. Its IUPAC name is 1-N,2-N,2-N,2-tetramethyl-1-(2,2,5,5-tetramethyloxolan-3-yl)butane-1,2-diamine.
| Compound Name | 1-N,2-N,2-N,2-tetramethyl-1-(2,2,5,5-tetramethyloxolan-3-yl)butane-1,2-diamine |
|---|---|
| PubChem CID | 114623234 |
| Molecular Formula | C16H34N2O |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.27 |
| IUPAC Name | 1-N,2-N,2-N,2-tetramethyl-1-(2,2,5,5-tetramethyloxolan-3-yl)butane-1,2-diamine |
| SMILES | CCC(C)(C(NC)C1CC(C)(C)OC1(C)C)N(C)C |
| InChI | InChI=1S/C16H34N2O/c1-10-16(6,18(8)9)13(17-7)12-11-14(2,3)19-15(12,4)5/h12-13,17H,10-11H2,1-9H3 |
| InChIKey | RSXRJGHCSJHITC-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |