C16H33NO — CID 114623279
N-propyl-1-(2,2,5,5-tetramethyloxolan-3-yl)pentan-1-amine (PubChem CID 114623279) has the molecular formula C16H33NO and a molecular weight of 255.45 g/mol. Its IUPAC name is N-propyl-1-(2,2,5,5-tetramethyloxolan-3-yl)pentan-1-amine.
| Compound Name | N-propyl-1-(2,2,5,5-tetramethyloxolan-3-yl)pentan-1-amine |
|---|---|
| PubChem CID | 114623279 |
| Molecular Formula | C16H33NO |
| Molecular Weight | 255.45 g/mol |
| Exact Mass | 255.26 |
| IUPAC Name | N-propyl-1-(2,2,5,5-tetramethyloxolan-3-yl)pentan-1-amine |
| SMILES | CCCCC(NCCC)C1CC(C)(C)OC1(C)C |
| InChI | InChI=1S/C16H33NO/c1-7-9-10-14(17-11-8-2)13-12-15(3,4)18-16(13,5)6/h13-14,17H,7-12H2,1-6H3 |
| InChIKey | ZWELOIPURAHEGZ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.45 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |