C12H18Br2O2 — CID 11462344
(5S)-5-(dibromomethyl)-2,2-dimethyl-4,4-bis(prop-2-enyl)-1,3-dioxolane (PubChem CID 11462344) has the molecular formula C12H18Br2O2 and a molecular weight of 354.08 g/mol. Its IUPAC name is (5S)-5-(dibromomethyl)-2,2-dimethyl-4,4-bis(prop-2-enyl)-1,3-dioxolane.
| Compound Name | (5S)-5-(dibromomethyl)-2,2-dimethyl-4,4-bis(prop-2-enyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 11462344 |
| Molecular Formula | C12H18Br2O2 |
| Molecular Weight | 354.08 g/mol |
| Exact Mass | 351.97 |
| IUPAC Name | (5S)-5-(dibromomethyl)-2,2-dimethyl-4,4-bis(prop-2-enyl)-1,3-dioxolane |
| SMILES | C=CCC1(CC=C)OC(C)(C)O[C@@H]1C(Br)Br |
| InChI | InChI=1S/C12H18Br2O2/c1-5-7-12(8-6-2)9(10(13)14)15-11(3,4)16-12/h5-6,9-10H,1-2,7-8H2,3-4H3/t9-/m1/s1 |
| InChIKey | LHECVGICKGGCCQ-SECBINFHSA-N |
| XLogP | 4.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.08 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|