C11H16ClN3O5S — CID 114623676
3-nitro-1-(2,2,5,5-tetramethyloxolan-3-yl)pyrazole-4-sulfonyl chloride (PubChem CID 114623676) has the molecular formula C11H16ClN3O5S and a molecular weight of 337.79 g/mol. Its IUPAC name is 3-nitro-1-(2,2,5,5-tetramethyloxolan-3-yl)pyrazole-4-sulfonyl chloride.
| Compound Name | 3-nitro-1-(2,2,5,5-tetramethyloxolan-3-yl)pyrazole-4-sulfonyl chloride |
|---|---|
| PubChem CID | 114623676 |
| Molecular Formula | C11H16ClN3O5S |
| Molecular Weight | 337.79 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | 3-nitro-1-(2,2,5,5-tetramethyloxolan-3-yl)pyrazole-4-sulfonyl chloride |
| SMILES | CC1(C)CC(n2cc(S(=O)(=O)Cl)c([N+](=O)[O-])n2)C(C)(C)O1 |
| InChI | InChI=1S/C11H16ClN3O5S/c1-10(2)5-8(11(3,4)20-10)14-6-7(21(12,18)19)9(13-14)15(16)17/h6,8H,5H2,1-4H3 |
| InChIKey | BJPBKQOSTGEIEX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 104.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.79 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|