C12H17IN2O2 — CID 114623701
5-iodo-2-(2,2,5,5-tetramethyloxolan-3-yl)pyridazin-3-one (PubChem CID 114623701) has the molecular formula C12H17IN2O2 and a molecular weight of 348.18 g/mol. Its IUPAC name is 5-iodo-2-(2,2,5,5-tetramethyloxolan-3-yl)pyridazin-3-one.
| Compound Name | 5-iodo-2-(2,2,5,5-tetramethyloxolan-3-yl)pyridazin-3-one |
|---|---|
| PubChem CID | 114623701 |
| Molecular Formula | C12H17IN2O2 |
| Molecular Weight | 348.18 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | 5-iodo-2-(2,2,5,5-tetramethyloxolan-3-yl)pyridazin-3-one |
| SMILES | CC1(C)CC(n2ncc(I)cc2=O)C(C)(C)O1 |
| InChI | InChI=1S/C12H17IN2O2/c1-11(2)6-9(12(3,4)17-11)15-10(16)5-8(13)7-14-15/h5,7,9H,6H2,1-4H3 |
| InChIKey | YAGXIWSLSBUYFW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.18 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|