C11H16ClN3O3 — CID 114623704
4-chloro-3-nitro-1-(2,2,5,5-tetramethyloxolan-3-yl)pyrazole (PubChem CID 114623704) has the molecular formula C11H16ClN3O3 and a molecular weight of 273.72 g/mol. Its IUPAC name is 4-chloro-3-nitro-1-(2,2,5,5-tetramethyloxolan-3-yl)pyrazole.
| Compound Name | 4-chloro-3-nitro-1-(2,2,5,5-tetramethyloxolan-3-yl)pyrazole |
|---|---|
| PubChem CID | 114623704 |
| Molecular Formula | C11H16ClN3O3 |
| Molecular Weight | 273.72 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 4-chloro-3-nitro-1-(2,2,5,5-tetramethyloxolan-3-yl)pyrazole |
| SMILES | CC1(C)CC(n2cc(Cl)c([N+](=O)[O-])n2)C(C)(C)O1 |
| InChI | InChI=1S/C11H16ClN3O3/c1-10(2)5-8(11(3,4)18-10)14-6-7(12)9(13-14)15(16)17/h6,8H,5H2,1-4H3 |
| InChIKey | VJTQBTBPXYATKQ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 70.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.72 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|