C20H18FNO4 — CID 11462395
methyl 6-fluoro-4-(3-phenoxypropoxy)quinoline-2-carboxylate (PubChem CID 11462395) has the molecular formula C20H18FNO4 and a molecular weight of 355.37 g/mol. Its IUPAC name is methyl 6-fluoro-4-(3-phenoxypropoxy)quinoline-2-carboxylate.
| Compound Name | methyl 6-fluoro-4-(3-phenoxypropoxy)quinoline-2-carboxylate |
|---|---|
| PubChem CID | 11462395 |
| Molecular Formula | C20H18FNO4 |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | methyl 6-fluoro-4-(3-phenoxypropoxy)quinoline-2-carboxylate |
| SMILES | COC(=O)c1cc(OCCCOc2ccccc2)c2cc(F)ccc2n1 |
| InChI | InChI=1S/C20H18FNO4/c1-24-20(23)18-13-19(16-12-14(21)8-9-17(16)22-18)26-11-5-10-25-15-6-3-2-4-7-15/h2-4,6-9,12-13H,5,10-11H2,1H3 |
| InChIKey | BXTCVIZUMBLBTF-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|