C13H20N2O — CID 114624107
3-(2,2,5,5-tetramethyloxolan-3-yl)pyridin-4-amine (PubChem CID 114624107) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is 3-(2,2,5,5-tetramethyloxolan-3-yl)pyridin-4-amine.
| Compound Name | 3-(2,2,5,5-tetramethyloxolan-3-yl)pyridin-4-amine |
|---|---|
| PubChem CID | 114624107 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 3-(2,2,5,5-tetramethyloxolan-3-yl)pyridin-4-amine |
| SMILES | CC1(C)CC(c2cnccc2N)C(C)(C)O1 |
| InChI | InChI=1S/C13H20N2O/c1-12(2)7-10(13(3,4)16-12)9-8-15-6-5-11(9)14/h5-6,8,10H,7H2,1-4H3,(H2,14,15) |
| InChIKey | DHQNQCOFVPPVLY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |