C14H30O6P2 — CID 11462423
6,6-bis(diethoxyphosphoryl)hex-1-ene (PubChem CID 11462423) has the molecular formula C14H30O6P2 and a molecular weight of 356.34 g/mol. Its IUPAC name is 6,6-bis(diethoxyphosphoryl)hex-1-ene.
| Compound Name | 6,6-bis(diethoxyphosphoryl)hex-1-ene |
|---|---|
| PubChem CID | 11462423 |
| Molecular Formula | C14H30O6P2 |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 6,6-bis(diethoxyphosphoryl)hex-1-ene |
| SMILES | C=CCCCC(P(=O)(OCC)OCC)P(=O)(OCC)OCC |
| InChI | InChI=1S/C14H30O6P2/c1-6-11-12-13-14(21(15,17-7-2)18-8-3)22(16,19-9-4)20-10-5/h6,14H,1,7-13H2,2-5H3 |
| InChIKey | MSNDBSJOVRNCRI-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|