C17H16N4O3S — CID 11462429
N-(10-hydroxy-1,3,12-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8,12-pentaen-13-yl)-4-methylbenzenesulfonamide (PubChem CID 11462429) has the molecular formula C17H16N4O3S and a molecular weight of 356.41 g/mol. Its IUPAC name is N-(10-hydroxy-1,3,12-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8,12-pentaen-13-yl)-4-methylbenzenesulfonamide.
| Compound Name | N-(10-hydroxy-1,3,12-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8,12-pentaen-13-yl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 11462429 |
| Molecular Formula | C17H16N4O3S |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | N-(10-hydroxy-1,3,12-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8,12-pentaen-13-yl)-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC2=NCC(O)c3cc4cccnc4n32)cc1 |
| InChI | InChI=1S/C17H16N4O3S/c1-11-4-6-13(7-5-11)25(23,24)20-17-19-10-15(22)14-9-12-3-2-8-18-16(12)21(14)17/h2-9,15,22H,10H2,1H3,(H,19,20) |
| InChIKey | AAMFETYGBRJDDV-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |