C10H20FNO — CID 114624505
2-fluoro-2-(2,2,5,5-tetramethyloxolan-3-yl)ethanamine (PubChem CID 114624505) has the molecular formula C10H20FNO and a molecular weight of 189.27 g/mol. Its IUPAC name is 2-fluoro-2-(2,2,5,5-tetramethyloxolan-3-yl)ethanamine.
| Compound Name | 2-fluoro-2-(2,2,5,5-tetramethyloxolan-3-yl)ethanamine |
|---|---|
| PubChem CID | 114624505 |
| Molecular Formula | C10H20FNO |
| Molecular Weight | 189.27 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 2-fluoro-2-(2,2,5,5-tetramethyloxolan-3-yl)ethanamine |
| SMILES | CC1(C)CC(C(F)CN)C(C)(C)O1 |
| InChI | InChI=1S/C10H20FNO/c1-9(2)5-7(8(11)6-12)10(3,4)13-9/h7-8H,5-6,12H2,1-4H3 |
| InChIKey | ZIUXAKPZGBDSOR-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.27 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |