C15H20ClNO2 — CID 114624557
(3-amino-4-chlorophenyl)-(2,2,5,5-tetramethyloxolan-3-yl)methanone (PubChem CID 114624557) has the molecular formula C15H20ClNO2 and a molecular weight of 281.78 g/mol. Its IUPAC name is (3-amino-4-chlorophenyl)-(2,2,5,5-tetramethyloxolan-3-yl)methanone.
| Compound Name | (3-amino-4-chlorophenyl)-(2,2,5,5-tetramethyloxolan-3-yl)methanone |
|---|---|
| PubChem CID | 114624557 |
| Molecular Formula | C15H20ClNO2 |
| Molecular Weight | 281.78 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | (3-amino-4-chlorophenyl)-(2,2,5,5-tetramethyloxolan-3-yl)methanone |
| SMILES | CC1(C)CC(C(=O)c2ccc(Cl)c(N)c2)C(C)(C)O1 |
| InChI | InChI=1S/C15H20ClNO2/c1-14(2)8-10(15(3,4)19-14)13(18)9-5-6-11(16)12(17)7-9/h5-7,10H,8,17H2,1-4H3 |
| InChIKey | HVWHQWXUEFWCED-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.78 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|