About [(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]methyl N-phenylcarbamate
[(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]methyl N-phenylcarbamate (PubChem CID 11462502) has the molecular formula C20H23ClN2O2
and a molecular weight of 358.87 g/mol. Its IUPAC name is [(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]methyl N-phenylcarbamate.
Molecular Properties
| Compound Name | [(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]methyl N-phenylcarbamate |
| PubChem CID | 11462502 |
| Molecular Formula | C20H23ClN2O2 |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | [(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]methyl N-phenylcarbamate |
| SMILES | CN1CC[C@H](c2ccc(Cl)cc2)[C@@H](COC(=O)Nc2ccccc2)C1 |
| InChI | InChI=1S/C20H23ClN2O2/c1-23-12-11-19(15-7-9-17(21)10-8-15)16(13-23)14-25-20(24)22-18-5-3-2-4-6-18/h2-10,16,19H,11-14H2,1H3,(H,22,24)/t16-,19-/m1/s1 |
| InChIKey | NMJUFTXXNHJCGA-VQIMIIECSA-N |
| XLogP | 4.62 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]methyl N-phenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]methyl N-phenylcarbamate?
The IUPAC name of [(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]methyl N-phenylcarbamate (CID 11462502) is [(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]methyl N-phenylcarbamate.
What is the SMILES notation for [(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]methyl N-phenylcarbamate?
The canonical SMILES for [(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]methyl N-phenylcarbamate is CN1CC[C@H](c2ccc(Cl)cc2)[C@@H](COC(=O)Nc2ccccc2)C1.
What is the InChIKey of [(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]methyl N-phenylcarbamate?
The InChIKey is NMJUFTXXNHJCGA-VQIMIIECSA-N. The full InChI is InChI=1S/C20H23ClN2O2/c1-23-12-11-19(15-7-9-17(21)10-8-15)16(13-23)14-25-20(24)22-18-5-3-2-4-6-18/h2-10,16,19H,11-14H2,1H3,(H,22,24)/t16-,19-/m1/s1.
What are the key properties of [(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]methyl N-phenylcarbamate?
[(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]methyl N-phenylcarbamate has a molecular weight of 358.87 g/mol, XLogP of 4.62, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,4S)-4-(4-chlorophenyl)-1-methylpiperidin-3-yl]methyl N-phenylcarbamate is sourced from PubChem (CID 11462502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).