C11H14BrF3N2O3S — CID 114625346
5-amino-4-bromo-N-(2-hydroxyethyl)-2-methyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide (PubChem CID 114625346) has the molecular formula C11H14BrF3N2O3S and a molecular weight of 391.21 g/mol. Its IUPAC name is 5-amino-4-bromo-N-(2-hydroxyethyl)-2-methyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide.
| Compound Name | 5-amino-4-bromo-N-(2-hydroxyethyl)-2-methyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 114625346 |
| Molecular Formula | C11H14BrF3N2O3S |
| Molecular Weight | 391.21 g/mol |
| Exact Mass | 389.99 |
| IUPAC Name | 5-amino-4-bromo-N-(2-hydroxyethyl)-2-methyl-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
| SMILES | Cc1cc(Br)c(N)cc1S(=O)(=O)N(CCO)CC(F)(F)F |
| InChI | InChI=1S/C11H14BrF3N2O3S/c1-7-4-8(12)9(16)5-10(7)21(19,20)17(2-3-18)6-11(13,14)15/h4-5,18H,2-3,6,16H2,1H3 |
| InChIKey | BAWSALKBOFHYQJ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.21 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|