C19H20O7 — CID 11462538
(4aS,6R,12bS)-3,4a,6,12b-tetrahydroxy-3-methyl-2,4,5,6,6a,12a-hexahydrobenzo[a]anthracene-1,7,12-trione (PubChem CID 11462538) has the molecular formula C19H20O7 and a molecular weight of 360.36 g/mol. Its IUPAC name is (4aS,6R,12bS)-3,4a,6,12b-tetrahydroxy-3-methyl-2,4,5,6,6a,12a-hexahydrobenzo[a]anthracene-1,7,12-trione.
| Compound Name | (4aS,6R,12bS)-3,4a,6,12b-tetrahydroxy-3-methyl-2,4,5,6,6a,12a-hexahydrobenzo[a]anthracene-1,7,12-trione |
|---|---|
| PubChem CID | 11462538 |
| Molecular Formula | C19H20O7 |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | (4aS,6R,12bS)-3,4a,6,12b-tetrahydroxy-3-methyl-2,4,5,6,6a,12a-hexahydrobenzo[a]anthracene-1,7,12-trione |
| SMILES | CC1(O)CC(=O)[C@]2(O)C3C(=O)c4ccccc4C(=O)C3[C@H](O)C[C@]2(O)C1 |
| InChI | InChI=1S/C19H20O7/c1-17(24)7-12(21)19(26)14-13(11(20)6-18(19,25)8-17)15(22)9-4-2-3-5-10(9)16(14)23/h2-5,11,13-14,20,24-26H,6-8H2,1H3/t11-,13?,14?,17?,18+,19+/m1/s1 |
| InChIKey | HIJKMBBGPWNPSG-UWGPAUOTSA-N |
| XLogP | -0.36 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'} |
|---|