C14H23F3N2OS — CID 114626833
2-piperidin-4-ylsulfanyl-N-[2-(trifluoromethyl)cyclohexyl]acetamide (PubChem CID 114626833) has the molecular formula C14H23F3N2OS and a molecular weight of 324.41 g/mol. Its IUPAC name is 2-piperidin-4-ylsulfanyl-N-[2-(trifluoromethyl)cyclohexyl]acetamide.
| Compound Name | 2-piperidin-4-ylsulfanyl-N-[2-(trifluoromethyl)cyclohexyl]acetamide |
|---|---|
| PubChem CID | 114626833 |
| Molecular Formula | C14H23F3N2OS |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 2-piperidin-4-ylsulfanyl-N-[2-(trifluoromethyl)cyclohexyl]acetamide |
| SMILES | O=C(CSC1CCNCC1)NC1CCCCC1C(F)(F)F |
| InChI | InChI=1S/C14H23F3N2OS/c15-14(16,17)11-3-1-2-4-12(11)19-13(20)9-21-10-5-7-18-8-6-10/h10-12,18H,1-9H2,(H,19,20) |
| InChIKey | LTTJSCXRPNXUSP-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |