C13H17FN2O2 — CID 114628218
3-amino-5-fluoro-N-(3-hydroxy-2,2-dimethylcyclobutyl)benzamide (PubChem CID 114628218) has the molecular formula C13H17FN2O2 and a molecular weight of 252.29 g/mol. Its IUPAC name is 3-amino-5-fluoro-N-(3-hydroxy-2,2-dimethylcyclobutyl)benzamide.
| Compound Name | 3-amino-5-fluoro-N-(3-hydroxy-2,2-dimethylcyclobutyl)benzamide |
|---|---|
| PubChem CID | 114628218 |
| Molecular Formula | C13H17FN2O2 |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 3-amino-5-fluoro-N-(3-hydroxy-2,2-dimethylcyclobutyl)benzamide |
| SMILES | CC1(C)C(O)CC1NC(=O)c1cc(N)cc(F)c1 |
| InChI | InChI=1S/C13H17FN2O2/c1-13(2)10(6-11(13)17)16-12(18)7-3-8(14)5-9(15)4-7/h3-5,10-11,17H,6,15H2,1-2H3,(H,16,18) |
| InChIKey | HGCDEZKAPDIAQJ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|