C12H16BrClN2O3S — CID 114628401
3-amino-2-bromo-5-chloro-N-(3-hydroxy-2,2-dimethylcyclobutyl)benzenesulfonamide (PubChem CID 114628401) has the molecular formula C12H16BrClN2O3S and a molecular weight of 383.70 g/mol. Its IUPAC name is 3-amino-2-bromo-5-chloro-N-(3-hydroxy-2,2-dimethylcyclobutyl)benzenesulfonamide.
| Compound Name | 3-amino-2-bromo-5-chloro-N-(3-hydroxy-2,2-dimethylcyclobutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 114628401 |
| Molecular Formula | C12H16BrClN2O3S |
| Molecular Weight | 383.70 g/mol |
| Exact Mass | 381.98 |
| IUPAC Name | 3-amino-2-bromo-5-chloro-N-(3-hydroxy-2,2-dimethylcyclobutyl)benzenesulfonamide |
| SMILES | CC1(C)C(O)CC1NS(=O)(=O)c1cc(Cl)cc(N)c1Br |
| InChI | InChI=1S/C12H16BrClN2O3S/c1-12(2)9(5-10(12)17)16-20(18,19)8-4-6(14)3-7(15)11(8)13/h3-4,9-10,16-17H,5,15H2,1-2H3 |
| InChIKey | WKSVPCRVSDDOMM-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.70 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|