C14H25N3S2 — CID 114628409
1-(2,4-dimethyl-1,3-thiazol-5-yl)-N-(2-piperidin-4-ylsulfanylethyl)ethanamine (PubChem CID 114628409) has the molecular formula C14H25N3S2 and a molecular weight of 299.51 g/mol. Its IUPAC name is 1-(2,4-dimethyl-1,3-thiazol-5-yl)-N-(2-piperidin-4-ylsulfanylethyl)ethanamine.
| Compound Name | 1-(2,4-dimethyl-1,3-thiazol-5-yl)-N-(2-piperidin-4-ylsulfanylethyl)ethanamine |
|---|---|
| PubChem CID | 114628409 |
| Molecular Formula | C14H25N3S2 |
| Molecular Weight | 299.51 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 1-(2,4-dimethyl-1,3-thiazol-5-yl)-N-(2-piperidin-4-ylsulfanylethyl)ethanamine |
| SMILES | Cc1nc(C)c(C(C)NCCSC2CCNCC2)s1 |
| InChI | InChI=1S/C14H25N3S2/c1-10(14-11(2)17-12(3)19-14)16-8-9-18-13-4-6-15-7-5-13/h10,13,15-16H,4-9H2,1-3H3 |
| InChIKey | MSDNKDMDVUWMSE-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.51 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|