About 3-(2-amino-4,5-dimethoxyanilino)-2,2-dimethylcyclobutan-1-ol
3-(2-amino-4,5-dimethoxyanilino)-2,2-dimethylcyclobutan-1-ol (PubChem CID 114628697) has the molecular formula C14H22N2O3
and a molecular weight of 266.34 g/mol. Its IUPAC name is 3-(2-amino-4,5-dimethoxyanilino)-2,2-dimethylcyclobutan-1-ol.
Molecular Properties
| Compound Name | 3-(2-amino-4,5-dimethoxyanilino)-2,2-dimethylcyclobutan-1-ol |
| PubChem CID | 114628697 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 3-(2-amino-4,5-dimethoxyanilino)-2,2-dimethylcyclobutan-1-ol |
| SMILES | COc1cc(N)c(NC2CC(O)C2(C)C)cc1OC |
| InChI | InChI=1S/C14H22N2O3/c1-14(2)12(7-13(14)17)16-9-6-11(19-4)10(18-3)5-8(9)15/h5-6,12-13,16-17H,7,15H2,1-4H3 |
| InChIKey | MJZPTKBAVMZSCW-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-amino-4,5-dimethoxyanilino)-2,2-dimethylcyclobutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-amino-4,5-dimethoxyanilino)-2,2-dimethylcyclobutan-1-ol?
The IUPAC name of 3-(2-amino-4,5-dimethoxyanilino)-2,2-dimethylcyclobutan-1-ol (CID 114628697) is 3-(2-amino-4,5-dimethoxyanilino)-2,2-dimethylcyclobutan-1-ol.
What is the SMILES notation for 3-(2-amino-4,5-dimethoxyanilino)-2,2-dimethylcyclobutan-1-ol?
The canonical SMILES for 3-(2-amino-4,5-dimethoxyanilino)-2,2-dimethylcyclobutan-1-ol is COc1cc(N)c(NC2CC(O)C2(C)C)cc1OC.
What is the InChIKey of 3-(2-amino-4,5-dimethoxyanilino)-2,2-dimethylcyclobutan-1-ol?
The InChIKey is MJZPTKBAVMZSCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O3/c1-14(2)12(7-13(14)17)16-9-6-11(19-4)10(18-3)5-8(9)15/h5-6,12-13,16-17H,7,15H2,1-4H3.
What are the key properties of 3-(2-amino-4,5-dimethoxyanilino)-2,2-dimethylcyclobutan-1-ol?
3-(2-amino-4,5-dimethoxyanilino)-2,2-dimethylcyclobutan-1-ol has a molecular weight of 266.34 g/mol, XLogP of 1.86, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-amino-4,5-dimethoxyanilino)-2,2-dimethylcyclobutan-1-ol is sourced from PubChem (CID 114628697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).