C20H18F2N2O3 — CID 11462899
(1S,6R)-7,7-bis(4-fluorophenyl)-2,4,6-trimethyl-8-oxa-2,4-diazabicyclo[4.2.0]octane-3,5-dione (PubChem CID 11462899) has the molecular formula C20H18F2N2O3 and a molecular weight of 372.37 g/mol. Its IUPAC name is (1S,6R)-7,7-bis(4-fluorophenyl)-2,4,6-trimethyl-8-oxa-2,4-diazabicyclo[4.2.0]octane-3,5-dione.
| Compound Name | (1S,6R)-7,7-bis(4-fluorophenyl)-2,4,6-trimethyl-8-oxa-2,4-diazabicyclo[4.2.0]octane-3,5-dione |
|---|---|
| PubChem CID | 11462899 |
| Molecular Formula | C20H18F2N2O3 |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | (1S,6R)-7,7-bis(4-fluorophenyl)-2,4,6-trimethyl-8-oxa-2,4-diazabicyclo[4.2.0]octane-3,5-dione |
| SMILES | CN1C(=O)N(C)[C@H]2OC(c3ccc(F)cc3)(c3ccc(F)cc3)[C@@]2(C)C1=O |
| InChI | InChI=1S/C20H18F2N2O3/c1-19-16(25)23(2)18(26)24(3)17(19)27-20(19,12-4-8-14(21)9-5-12)13-6-10-15(22)11-7-13/h4-11,17H,1-3H3/t17-,19-/m0/s1 |
| InChIKey | WSTMCMNXWSSEOM-HKUYNNGSSA-N |
| XLogP | 3.09 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |