C15H30N2O — CID 114629183
2,2-dimethyl-3-[(1-propylazepan-4-yl)amino]cyclobutan-1-ol (PubChem CID 114629183) has the molecular formula C15H30N2O and a molecular weight of 254.42 g/mol. Its IUPAC name is 2,2-dimethyl-3-[(1-propylazepan-4-yl)amino]cyclobutan-1-ol.
| Compound Name | 2,2-dimethyl-3-[(1-propylazepan-4-yl)amino]cyclobutan-1-ol |
|---|---|
| PubChem CID | 114629183 |
| Molecular Formula | C15H30N2O |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | 2,2-dimethyl-3-[(1-propylazepan-4-yl)amino]cyclobutan-1-ol |
| SMILES | CCCN1CCCC(NC2CC(O)C2(C)C)CC1 |
| InChI | InChI=1S/C15H30N2O/c1-4-8-17-9-5-6-12(7-10-17)16-13-11-14(18)15(13,2)3/h12-14,16,18H,4-11H2,1-3H3 |
| InChIKey | AFOUXCAOTUANNI-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |