C25H42O2 — CID 11462981
(3R,8R,9S,10S,13S,14S)-3-hexoxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one (PubChem CID 11462981) has the molecular formula C25H42O2 and a molecular weight of 374.61 g/mol. Its IUPAC name is (3R,8R,9S,10S,13S,14S)-3-hexoxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one.
| Compound Name | (3R,8R,9S,10S,13S,14S)-3-hexoxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 11462981 |
| Molecular Formula | C25H42O2 |
| Molecular Weight | 374.61 g/mol |
| Exact Mass | 374.32 |
| IUPAC Name | (3R,8R,9S,10S,13S,14S)-3-hexoxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
| SMILES | CCCCCCO[C@@H]1CC[C@@]2(C)C(CC[C@@H]3[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]32)C1 |
| InChI | InChI=1S/C25H42O2/c1-4-5-6-7-16-27-19-12-14-24(2)18(17-19)8-9-20-21-10-11-23(26)25(21,3)15-13-22(20)24/h18-22H,4-17H2,1-3H3/t18?,19-,20+,21+,22+,24+,25+/m1/s1 |
| InChIKey | WZUFCJOKVUYXDX-CCFTWUMISA-N |
| XLogP | 6.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.61 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|