About N-(3-hydroxy-2,2-dimethylcyclobutyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide
N-(3-hydroxy-2,2-dimethylcyclobutyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide (PubChem CID 114630580) has the molecular formula C14H22F3NO2
and a molecular weight of 293.33 g/mol. Its IUPAC name is N-(3-hydroxy-2,2-dimethylcyclobutyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide.
Molecular Properties
| Compound Name | N-(3-hydroxy-2,2-dimethylcyclobutyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide |
| PubChem CID | 114630580 |
| Molecular Formula | C14H22F3NO2 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | N-(3-hydroxy-2,2-dimethylcyclobutyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide |
| SMILES | CC1(C)C(O)CC1NC(=O)C1CCCCC1C(F)(F)F |
| InChI | InChI=1S/C14H22F3NO2/c1-13(2)10(7-11(13)19)18-12(20)8-5-3-4-6-9(8)14(15,16)17/h8-11,19H,3-7H2,1-2H3,(H,18,20) |
| InChIKey | CDAOSIZQPCOXCO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(3-hydroxy-2,2-dimethylcyclobutyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-hydroxy-2,2-dimethylcyclobutyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide?
The IUPAC name of N-(3-hydroxy-2,2-dimethylcyclobutyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide (CID 114630580) is N-(3-hydroxy-2,2-dimethylcyclobutyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide.
What is the SMILES notation for N-(3-hydroxy-2,2-dimethylcyclobutyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide?
The canonical SMILES for N-(3-hydroxy-2,2-dimethylcyclobutyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide is CC1(C)C(O)CC1NC(=O)C1CCCCC1C(F)(F)F.
What is the InChIKey of N-(3-hydroxy-2,2-dimethylcyclobutyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide?
The InChIKey is CDAOSIZQPCOXCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22F3NO2/c1-13(2)10(7-11(13)19)18-12(20)8-5-3-4-6-9(8)14(15,16)17/h8-11,19H,3-7H2,1-2H3,(H,18,20).
What are the key properties of N-(3-hydroxy-2,2-dimethylcyclobutyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide?
N-(3-hydroxy-2,2-dimethylcyclobutyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide has a molecular weight of 293.33 g/mol, XLogP of 2.63, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-hydroxy-2,2-dimethylcyclobutyl)-2-(trifluoromethyl)cyclohexane-1-carboxamide is sourced from PubChem (CID 114630580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).