C15H21NO3 — CID 114630677
N-(3-hydroxy-2,2-dimethylcyclobutyl)-3-(methoxymethyl)benzamide (PubChem CID 114630677) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is N-(3-hydroxy-2,2-dimethylcyclobutyl)-3-(methoxymethyl)benzamide.
| Compound Name | N-(3-hydroxy-2,2-dimethylcyclobutyl)-3-(methoxymethyl)benzamide |
|---|---|
| PubChem CID | 114630677 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | N-(3-hydroxy-2,2-dimethylcyclobutyl)-3-(methoxymethyl)benzamide |
| SMILES | COCc1cccc(C(=O)NC2CC(O)C2(C)C)c1 |
| InChI | InChI=1S/C15H21NO3/c1-15(2)12(8-13(15)17)16-14(18)11-6-4-5-10(7-11)9-19-3/h4-7,12-13,17H,8-9H2,1-3H3,(H,16,18) |
| InChIKey | KIVQWXLDTRJBKK-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |