About N-(3-hydroxy-2,2-dimethylcyclobutyl)-2-(3-nitropyrazol-1-yl)acetamide
N-(3-hydroxy-2,2-dimethylcyclobutyl)-2-(3-nitropyrazol-1-yl)acetamide (PubChem CID 114630924) has the molecular formula C11H16N4O4
and a molecular weight of 268.27 g/mol. Its IUPAC name is N-(3-hydroxy-2,2-dimethylcyclobutyl)-2-(3-nitropyrazol-1-yl)acetamide.
Molecular Properties
| Compound Name | N-(3-hydroxy-2,2-dimethylcyclobutyl)-2-(3-nitropyrazol-1-yl)acetamide |
| PubChem CID | 114630924 |
| Molecular Formula | C11H16N4O4 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | N-(3-hydroxy-2,2-dimethylcyclobutyl)-2-(3-nitropyrazol-1-yl)acetamide |
| SMILES | CC1(C)C(O)CC1NC(=O)Cn1ccc([N+](=O)[O-])n1 |
| InChI | InChI=1S/C11H16N4O4/c1-11(2)7(5-8(11)16)12-10(17)6-14-4-3-9(13-14)15(18)19/h3-4,7-8,16H,5-6H2,1-2H3,(H,12,17) |
| InChIKey | KKHKYFFRIMZYED-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(3-hydroxy-2,2-dimethylcyclobutyl)-2-(3-nitropyrazol-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-hydroxy-2,2-dimethylcyclobutyl)-2-(3-nitropyrazol-1-yl)acetamide?
The IUPAC name of N-(3-hydroxy-2,2-dimethylcyclobutyl)-2-(3-nitropyrazol-1-yl)acetamide (CID 114630924) is N-(3-hydroxy-2,2-dimethylcyclobutyl)-2-(3-nitropyrazol-1-yl)acetamide.
What is the SMILES notation for N-(3-hydroxy-2,2-dimethylcyclobutyl)-2-(3-nitropyrazol-1-yl)acetamide?
The canonical SMILES for N-(3-hydroxy-2,2-dimethylcyclobutyl)-2-(3-nitropyrazol-1-yl)acetamide is CC1(C)C(O)CC1NC(=O)Cn1ccc([N+](=O)[O-])n1.
What is the InChIKey of N-(3-hydroxy-2,2-dimethylcyclobutyl)-2-(3-nitropyrazol-1-yl)acetamide?
The InChIKey is KKHKYFFRIMZYED-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4O4/c1-11(2)7(5-8(11)16)12-10(17)6-14-4-3-9(13-14)15(18)19/h3-4,7-8,16H,5-6H2,1-2H3,(H,12,17).
What are the key properties of N-(3-hydroxy-2,2-dimethylcyclobutyl)-2-(3-nitropyrazol-1-yl)acetamide?
N-(3-hydroxy-2,2-dimethylcyclobutyl)-2-(3-nitropyrazol-1-yl)acetamide has a molecular weight of 268.27 g/mol, XLogP of 0.07, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-hydroxy-2,2-dimethylcyclobutyl)-2-(3-nitropyrazol-1-yl)acetamide is sourced from PubChem (CID 114630924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).