C23H22FNO3 — CID 11463098
3-fluoro-4-[(E,3E)-3-hydroxyimino-3-(5,8,8-trimethyl-7H-naphthalen-2-yl)prop-1-enyl]benzoic acid (PubChem CID 11463098) has the molecular formula C23H22FNO3 and a molecular weight of 379.43 g/mol. Its IUPAC name is 3-fluoro-4-[(E,3E)-3-hydroxyimino-3-(5,8,8-trimethyl-7H-naphthalen-2-yl)prop-1-enyl]benzoic acid.
| Compound Name | 3-fluoro-4-[(E,3E)-3-hydroxyimino-3-(5,8,8-trimethyl-7H-naphthalen-2-yl)prop-1-enyl]benzoic acid |
|---|---|
| PubChem CID | 11463098 |
| Molecular Formula | C23H22FNO3 |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 3-fluoro-4-[(E,3E)-3-hydroxyimino-3-(5,8,8-trimethyl-7H-naphthalen-2-yl)prop-1-enyl]benzoic acid |
| SMILES | CC1=CCC(C)(C)c2cc(C(/C=C/c3ccc(C(=O)O)cc3F)=N/O)ccc21 |
| InChI | InChI=1S/C23H22FNO3/c1-14-10-11-23(2,3)19-12-16(6-8-18(14)19)21(25-28)9-7-15-4-5-17(22(26)27)13-20(15)24/h4-10,12-13,28H,11H2,1-3H3,(H,26,27)/b9-7+,25-21+ |
| InChIKey | WSLBLPPYEJLZAI-PLHBOZHNSA-N |
| XLogP | 5.50 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|