C10H21NO3S — CID 114631480
N-(3-hydroxy-2,2-dimethylcyclobutyl)butane-1-sulfonamide (PubChem CID 114631480) has the molecular formula C10H21NO3S and a molecular weight of 235.35 g/mol. Its IUPAC name is N-(3-hydroxy-2,2-dimethylcyclobutyl)butane-1-sulfonamide.
| Compound Name | N-(3-hydroxy-2,2-dimethylcyclobutyl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 114631480 |
| Molecular Formula | C10H21NO3S |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | N-(3-hydroxy-2,2-dimethylcyclobutyl)butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)NC1CC(O)C1(C)C |
| InChI | InChI=1S/C10H21NO3S/c1-4-5-6-15(13,14)11-8-7-9(12)10(8,2)3/h8-9,11-12H,4-7H2,1-3H3 |
| InChIKey | QUQUCTFQCJGMFZ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |