About N-(3-hydroxy-2,2-dimethylcyclobutyl)-2,2-dimethylpropane-1-sulfonamide
N-(3-hydroxy-2,2-dimethylcyclobutyl)-2,2-dimethylpropane-1-sulfonamide (PubChem CID 114631559) has the molecular formula C11H23NO3S
and a molecular weight of 249.38 g/mol. Its IUPAC name is N-(3-hydroxy-2,2-dimethylcyclobutyl)-2,2-dimethylpropane-1-sulfonamide.
Molecular Properties
| Compound Name | N-(3-hydroxy-2,2-dimethylcyclobutyl)-2,2-dimethylpropane-1-sulfonamide |
| PubChem CID | 114631559 |
| Molecular Formula | C11H23NO3S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | N-(3-hydroxy-2,2-dimethylcyclobutyl)-2,2-dimethylpropane-1-sulfonamide |
| SMILES | CC(C)(C)CS(=O)(=O)NC1CC(O)C1(C)C |
| InChI | InChI=1S/C11H23NO3S/c1-10(2,3)7-16(14,15)12-8-6-9(13)11(8,4)5/h8-9,12-13H,6-7H2,1-5H3 |
| InChIKey | CMZLAJHJMDRWLD-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(3-hydroxy-2,2-dimethylcyclobutyl)-2,2-dimethylpropane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-hydroxy-2,2-dimethylcyclobutyl)-2,2-dimethylpropane-1-sulfonamide?
The IUPAC name of N-(3-hydroxy-2,2-dimethylcyclobutyl)-2,2-dimethylpropane-1-sulfonamide (CID 114631559) is N-(3-hydroxy-2,2-dimethylcyclobutyl)-2,2-dimethylpropane-1-sulfonamide.
What is the SMILES notation for N-(3-hydroxy-2,2-dimethylcyclobutyl)-2,2-dimethylpropane-1-sulfonamide?
The canonical SMILES for N-(3-hydroxy-2,2-dimethylcyclobutyl)-2,2-dimethylpropane-1-sulfonamide is CC(C)(C)CS(=O)(=O)NC1CC(O)C1(C)C.
What is the InChIKey of N-(3-hydroxy-2,2-dimethylcyclobutyl)-2,2-dimethylpropane-1-sulfonamide?
The InChIKey is CMZLAJHJMDRWLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO3S/c1-10(2,3)7-16(14,15)12-8-6-9(13)11(8,4)5/h8-9,12-13H,6-7H2,1-5H3.
What are the key properties of N-(3-hydroxy-2,2-dimethylcyclobutyl)-2,2-dimethylpropane-1-sulfonamide?
N-(3-hydroxy-2,2-dimethylcyclobutyl)-2,2-dimethylpropane-1-sulfonamide has a molecular weight of 249.38 g/mol, XLogP of 1.11, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-hydroxy-2,2-dimethylcyclobutyl)-2,2-dimethylpropane-1-sulfonamide is sourced from PubChem (CID 114631559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).