C12H15Cl2NO3S — CID 114631595
2,6-dichloro-N-(3-hydroxy-2,2-dimethylcyclobutyl)benzenesulfonamide (PubChem CID 114631595) has the molecular formula C12H15Cl2NO3S and a molecular weight of 324.23 g/mol. Its IUPAC name is 2,6-dichloro-N-(3-hydroxy-2,2-dimethylcyclobutyl)benzenesulfonamide.
| Compound Name | 2,6-dichloro-N-(3-hydroxy-2,2-dimethylcyclobutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 114631595 |
| Molecular Formula | C12H15Cl2NO3S |
| Molecular Weight | 324.23 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | 2,6-dichloro-N-(3-hydroxy-2,2-dimethylcyclobutyl)benzenesulfonamide |
| SMILES | CC1(C)C(O)CC1NS(=O)(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H15Cl2NO3S/c1-12(2)9(6-10(12)16)15-19(17,18)11-7(13)4-3-5-8(11)14/h3-5,9-10,15-16H,6H2,1-2H3 |
| InChIKey | BXNBQHWDBVAISZ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.23 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |