C8H17NO3S — CID 114631629
N-(3-hydroxy-2,2-dimethylcyclobutyl)ethanesulfonamide (PubChem CID 114631629) has the molecular formula C8H17NO3S and a molecular weight of 207.29 g/mol. Its IUPAC name is N-(3-hydroxy-2,2-dimethylcyclobutyl)ethanesulfonamide.
| Compound Name | N-(3-hydroxy-2,2-dimethylcyclobutyl)ethanesulfonamide |
|---|---|
| PubChem CID | 114631629 |
| Molecular Formula | C8H17NO3S |
| Molecular Weight | 207.29 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | N-(3-hydroxy-2,2-dimethylcyclobutyl)ethanesulfonamide |
| SMILES | CCS(=O)(=O)NC1CC(O)C1(C)C |
| InChI | InChI=1S/C8H17NO3S/c1-4-13(11,12)9-6-5-7(10)8(6,2)3/h6-7,9-10H,4-5H2,1-3H3 |
| InChIKey | JJVJACPEXZJMNY-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.29 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |