About N-(3-chloro-2,2-dimethylcyclobutyl)-5-iodopyrimidin-2-amine
N-(3-chloro-2,2-dimethylcyclobutyl)-5-iodopyrimidin-2-amine (PubChem CID 114632036) has the molecular formula C10H13ClIN3
and a molecular weight of 337.59 g/mol. Its IUPAC name is N-(3-chloro-2,2-dimethylcyclobutyl)-5-iodopyrimidin-2-amine.
Molecular Properties
| Compound Name | N-(3-chloro-2,2-dimethylcyclobutyl)-5-iodopyrimidin-2-amine |
| PubChem CID | 114632036 |
| Molecular Formula | C10H13ClIN3 |
| Molecular Weight | 337.59 g/mol |
| Exact Mass | 336.98 |
| IUPAC Name | N-(3-chloro-2,2-dimethylcyclobutyl)-5-iodopyrimidin-2-amine |
| SMILES | CC1(C)C(Cl)CC1Nc1ncc(I)cn1 |
| InChI | InChI=1S/C10H13ClIN3/c1-10(2)7(11)3-8(10)15-9-13-4-6(12)5-14-9/h4-5,7-8H,3H2,1-2H3,(H,13,14,15) |
| InChIKey | KAHNZHVSLFTTAR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.59 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N-(3-chloro-2,2-dimethylcyclobutyl)-5-iodopyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-chloro-2,2-dimethylcyclobutyl)-5-iodopyrimidin-2-amine?
The IUPAC name of N-(3-chloro-2,2-dimethylcyclobutyl)-5-iodopyrimidin-2-amine (CID 114632036) is N-(3-chloro-2,2-dimethylcyclobutyl)-5-iodopyrimidin-2-amine.
What is the SMILES notation for N-(3-chloro-2,2-dimethylcyclobutyl)-5-iodopyrimidin-2-amine?
The canonical SMILES for N-(3-chloro-2,2-dimethylcyclobutyl)-5-iodopyrimidin-2-amine is CC1(C)C(Cl)CC1Nc1ncc(I)cn1.
What is the InChIKey of N-(3-chloro-2,2-dimethylcyclobutyl)-5-iodopyrimidin-2-amine?
The InChIKey is KAHNZHVSLFTTAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13ClIN3/c1-10(2)7(11)3-8(10)15-9-13-4-6(12)5-14-9/h4-5,7-8H,3H2,1-2H3,(H,13,14,15).
What are the key properties of N-(3-chloro-2,2-dimethylcyclobutyl)-5-iodopyrimidin-2-amine?
N-(3-chloro-2,2-dimethylcyclobutyl)-5-iodopyrimidin-2-amine has a molecular weight of 337.59 g/mol, XLogP of 2.90, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-chloro-2,2-dimethylcyclobutyl)-5-iodopyrimidin-2-amine is sourced from PubChem (CID 114632036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).