About 3-[2,6-diamino-5-(3-chlorophenyl)pyrimidin-4-yl]propyl benzoate
3-[2,6-diamino-5-(3-chlorophenyl)pyrimidin-4-yl]propyl benzoate (PubChem CID 11463215) has the molecular formula C20H19ClN4O2
and a molecular weight of 382.85 g/mol. Its IUPAC name is 3-[2,6-diamino-5-(3-chlorophenyl)pyrimidin-4-yl]propyl benzoate.
Molecular Properties
| Compound Name | 3-[2,6-diamino-5-(3-chlorophenyl)pyrimidin-4-yl]propyl benzoate |
| PubChem CID | 11463215 |
| Molecular Formula | C20H19ClN4O2 |
| Molecular Weight | 382.85 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 3-[2,6-diamino-5-(3-chlorophenyl)pyrimidin-4-yl]propyl benzoate |
| SMILES | Nc1nc(N)c(-c2cccc(Cl)c2)c(CCCOC(=O)c2ccccc2)n1 |
| InChI | InChI=1S/C20H19ClN4O2/c21-15-9-4-8-14(12-15)17-16(24-20(23)25-18(17)22)10-5-11-27-19(26)13-6-2-1-3-7-13/h1-4,6-9,12H,5,10-11H2,(H4,22,23,24,25) |
| InChIKey | TYRQFXXHSFDACD-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 104.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.85 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[2,6-diamino-5-(3-chlorophenyl)pyrimidin-4-yl]propyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2,6-diamino-5-(3-chlorophenyl)pyrimidin-4-yl]propyl benzoate?
The IUPAC name of 3-[2,6-diamino-5-(3-chlorophenyl)pyrimidin-4-yl]propyl benzoate (CID 11463215) is 3-[2,6-diamino-5-(3-chlorophenyl)pyrimidin-4-yl]propyl benzoate.
What is the SMILES notation for 3-[2,6-diamino-5-(3-chlorophenyl)pyrimidin-4-yl]propyl benzoate?
The canonical SMILES for 3-[2,6-diamino-5-(3-chlorophenyl)pyrimidin-4-yl]propyl benzoate is Nc1nc(N)c(-c2cccc(Cl)c2)c(CCCOC(=O)c2ccccc2)n1.
What is the InChIKey of 3-[2,6-diamino-5-(3-chlorophenyl)pyrimidin-4-yl]propyl benzoate?
The InChIKey is TYRQFXXHSFDACD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19ClN4O2/c21-15-9-4-8-14(12-15)17-16(24-20(23)25-18(17)22)10-5-11-27-19(26)13-6-2-1-3-7-13/h1-4,6-9,12H,5,10-11H2,(H4,22,23,24,25).
What are the key properties of 3-[2,6-diamino-5-(3-chlorophenyl)pyrimidin-4-yl]propyl benzoate?
3-[2,6-diamino-5-(3-chlorophenyl)pyrimidin-4-yl]propyl benzoate has a molecular weight of 382.85 g/mol, XLogP of 3.75, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2,6-diamino-5-(3-chlorophenyl)pyrimidin-4-yl]propyl benzoate is sourced from PubChem (CID 11463215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).